About N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine
N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine (PubChem CID 62468212) has the molecular formula C10H11N3S2
and a molecular weight of 237.35 g/mol. Its IUPAC name is N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| PubChem CID | 62468212 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| SMILES | CNc1ncccc1CSc1nccs1 |
| InChI | InChI=1S/C10H11N3S2/c1-11-9-8(3-2-4-12-9)7-15-10-13-5-6-14-10/h2-6H,7H2,1H3,(H,11,12) |
| InChIKey | WCAVKKMSYXIDMM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The IUPAC name of N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine (CID 62468212) is N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine.
What is the SMILES notation for N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The canonical SMILES for N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine is CNc1ncccc1CSc1nccs1.
What is the InChIKey of N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The InChIKey is WCAVKKMSYXIDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S2/c1-11-9-8(3-2-4-12-9)7-15-10-13-5-6-14-10/h2-6H,7H2,1H3,(H,11,12).
What are the key properties of N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine?
N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine has a molecular weight of 237.35 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(1,3-thiazol-2-ylsulfanylmethyl)pyridin-2-amine is sourced from PubChem (CID 62468212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).