About Thenyldiamine
Thenyldiamine (PubChem CID 7066) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | Thenyldiamine |
| PubChem CID | 7066 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(CC1=CSC=C1)C2=CC=CC=N2 |
| InChI | InChI=1S/C14H19N3S/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14/h3-7,10,12H,8-9,11H2,1-2H3 |
| InChIKey | RCGYDFVCAAKKNG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 235 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Thenyldiamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Thenyldiamine?
The IUPAC name of Thenyldiamine (CID 7066) is N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for Thenyldiamine?
The canonical SMILES for Thenyldiamine is CN(C)CCN(CC1=CSC=C1)C2=CC=CC=N2.
What is the InChIKey of Thenyldiamine?
The InChIKey is RCGYDFVCAAKKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14/h3-7,10,12H,8-9,11H2,1-2H3.
What are the key properties of Thenyldiamine?
Thenyldiamine has a molecular weight of 261.39 g/mol, XLogP of 3.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Thenyldiamine is sourced from PubChem (CID 7066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).