C11H13N3S — CID 10966027
4-piperazin-1-ylthieno[3,2-c]pyridine (PubChem CID 10966027) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-piperazin-1-ylthieno[3,2-c]pyridine.
| Compound Name | 4-piperazin-1-ylthieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 10966027 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-piperazin-1-ylthieno[3,2-c]pyridine |
| SMILES | c1cc2sccc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C11H13N3S/c1-3-13-11(9-2-8-15-10(1)9)14-6-4-12-5-7-14/h1-3,8,12H,4-7H2 |
| InChIKey | RVGRTFBJOXMFAX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |