C10H12N4OS3 — CID 80746056
5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 80746056) has the molecular formula C10H12N4OS3 and a molecular weight of 300.43 g/mol. Its IUPAC name is 5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 80746056 |
| Molecular Formula | C10H12N4OS3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | Cc1nnc(SCc2cc(C(=O)NN)sc2C)s1 |
| InChI | InChI=1S/C10H12N4OS3/c1-5-7(3-8(17-5)9(15)12-11)4-16-10-14-13-6(2)18-10/h3H,4,11H2,1-2H3,(H,12,15) |
| InChIKey | YMOIMHFLSFYQAT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|