C14H20N2O3S2 — CID 107778289
methyl 2-[1-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107778289) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is methyl 2-[1-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778289 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | methyl 2-[1-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2cc(C(=O)NN)sc2C)CC1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-9-10(5-11(21-9)13(18)16-15)7-20-8-14(3-4-14)6-12(17)19-2/h5H,3-4,6-8,15H2,1-2H3,(H,16,18) |
| InChIKey | VYSGHDKFUVTMQB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|