C13H18N2O2S — CID 107778138
methyl 2-[1-[(4-amino-2-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107778138) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl 2-[1-[(4-amino-2-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(4-amino-2-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778138 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 2-[1-[(4-amino-2-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2cc(N)ccn2)CC1 |
| InChI | InChI=1S/C13H18N2O2S/c1-17-12(16)7-13(3-4-13)9-18-8-11-6-10(14)2-5-15-11/h2,5-6H,3-4,7-9H2,1H3,(H2,14,15) |
| InChIKey | ZJFBWOBGEHDHCP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |