C11H19N3OS2 — CID 80745366
4-[(2-amino-2-methylpropyl)sulfanylmethyl]-5-methylthiophene-2-carbohydrazide (PubChem CID 80745366) has the molecular formula C11H19N3OS2 and a molecular weight of 273.43 g/mol. Its IUPAC name is 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-5-methylthiophene-2-carbohydrazide.
| Compound Name | 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 80745366 |
| Molecular Formula | C11H19N3OS2 |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-5-methylthiophene-2-carbohydrazide |
| SMILES | Cc1sc(C(=O)NN)cc1CSCC(C)(C)N |
| InChI | InChI=1S/C11H19N3OS2/c1-7-8(5-16-6-11(2,3)12)4-9(17-7)10(15)14-13/h4H,5-6,12-13H2,1-3H3,(H,14,15) |
| InChIKey | MMCBUEVLMCAUKM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|