C10H10ClN3S2 — CID 79583319
4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline (PubChem CID 79583319) has the molecular formula C10H10ClN3S2 and a molecular weight of 271.80 g/mol. Its IUPAC name is 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline.
| Compound Name | 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 79583319 |
| Molecular Formula | C10H10ClN3S2 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
| SMILES | Cc1nnc(SCc2cc(Cl)ccc2N)s1 |
| InChI | InChI=1S/C10H10ClN3S2/c1-6-13-14-10(16-6)15-5-7-4-8(11)2-3-9(7)12/h2-4H,5,12H2,1H3 |
| InChIKey | WHLYUTBDCQBBKZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|