C12H14N2OS3 — CID 47095941
2-[2-(2-methylphenoxy)ethylsulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 47095941) has the molecular formula C12H14N2OS3 and a molecular weight of 298.46 g/mol. Its IUPAC name is 2-[2-(2-methylphenoxy)ethylsulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-[2-(2-methylphenoxy)ethylsulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 47095941 |
| Molecular Formula | C12H14N2OS3 |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-[2-(2-methylphenoxy)ethylsulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CSc1nnc(SCCOc2ccccc2C)s1 |
| InChI | InChI=1S/C12H14N2OS3/c1-9-5-3-4-6-10(9)15-7-8-17-12-14-13-11(16-2)18-12/h3-6H,7-8H2,1-2H3 |
| InChIKey | VFWOTYCVMGDIMX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|