C13H17N3OS3 — CID 115383238
2-[4-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]phenyl]ethanamine (PubChem CID 115383238) has the molecular formula C13H17N3OS3 and a molecular weight of 327.50 g/mol. Its IUPAC name is 2-[4-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]phenyl]ethanamine.
| Compound Name | 2-[4-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 115383238 |
| Molecular Formula | C13H17N3OS3 |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-[4-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]phenyl]ethanamine |
| SMILES | CSc1nnc(SCCOc2ccc(CCN)cc2)s1 |
| InChI | InChI=1S/C13H17N3OS3/c1-18-12-15-16-13(20-12)19-9-8-17-11-4-2-10(3-5-11)6-7-14/h2-5H,6-9,14H2,1H3 |
| InChIKey | ITHWCTKCTCIJCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|