C13H17N3O3S4 — CID 17418416
4-[2-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 17418416) has the molecular formula C13H17N3O3S4 and a molecular weight of 391.57 g/mol. Its IUPAC name is 4-[2-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 17418416 |
| Molecular Formula | C13H17N3O3S4 |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 4-[2-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | CCCSc1nnc(SCCOc2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C13H17N3O3S4/c1-2-8-20-12-15-16-13(22-12)21-9-7-19-10-3-5-11(6-4-10)23(14,17)18/h3-6H,2,7-9H2,1H3,(H2,14,17,18) |
| InChIKey | URXYBAYGMNUJJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|