C16H18N4O3S3 — CID 8575473
4-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 8575473) has the molecular formula C16H18N4O3S3 and a molecular weight of 410.55 g/mol. Its IUPAC name is 4-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 8575473 |
| Molecular Formula | C16H18N4O3S3 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 4-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | CCn1c(SCCOc2ccc(S(N)(=O)=O)cc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C16H18N4O3S3/c1-2-20-15(14-4-3-10-24-14)18-19-16(20)25-11-9-23-12-5-7-13(8-6-12)26(17,21)22/h3-8,10H,2,9,11H2,1H3,(H2,17,21,22) |
| InChIKey | ATBQLOJSGHEAMM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|