C17H19N3OS2 — CID 112774267
4-ethyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 112774267) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-ethyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-ethyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 112774267 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-ethyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | CCn1c(SCCOc2cccc(C)c2)nnc1-c1cccs1 |
| InChI | InChI=1S/C17H19N3OS2/c1-3-20-16(15-8-5-10-22-15)18-19-17(20)23-11-9-21-14-7-4-6-13(2)12-14/h4-8,10,12H,3,9,11H2,1-2H3 |
| InChIKey | ISGFFKXREAKJSH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|