C17H16FN3OS2 — CID 55665056
4-cyclopropyl-3-[2-(3-fluorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 55665056) has the molecular formula C17H16FN3OS2 and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-cyclopropyl-3-[2-(3-fluorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-cyclopropyl-3-[2-(3-fluorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 55665056 |
| Molecular Formula | C17H16FN3OS2 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-cyclopropyl-3-[2-(3-fluorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | Fc1cccc(OCCSc2nnc(-c3cccs3)n2C2CC2)c1 |
| InChI | InChI=1S/C17H16FN3OS2/c18-12-3-1-4-14(11-12)22-8-10-24-17-20-19-16(15-5-2-9-23-15)21(17)13-6-7-13/h1-5,9,11,13H,6-8,10H2 |
| InChIKey | JBCIXWGJXPGAJC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|