C17H15Cl2N3OS2 — CID 7649259
4-cyclopropyl-3-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 7649259) has the molecular formula C17H15Cl2N3OS2 and a molecular weight of 412.37 g/mol. Its IUPAC name is 4-cyclopropyl-3-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-cyclopropyl-3-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 7649259 |
| Molecular Formula | C17H15Cl2N3OS2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 4-cyclopropyl-3-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | Clc1cccc(Cl)c1OCCSc1nnc(-c2cccs2)n1C1CC1 |
| InChI | InChI=1S/C17H15Cl2N3OS2/c18-12-3-1-4-13(19)15(12)23-8-10-25-17-21-20-16(14-5-2-9-24-14)22(17)11-6-7-11/h1-5,9,11H,6-8,10H2 |
| InChIKey | JYCKXNYVABZQPM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|