C22H20N4OS — CID 16569095
4-[5-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 16569095) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 4-[5-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[5-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 16569095 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-[5-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | Cc1cccc(OCCSc2nnc(-c3ccncc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C22H20N4OS/c1-17-6-5-9-20(16-17)27-14-15-28-22-25-24-21(18-10-12-23-13-11-18)26(22)19-7-3-2-4-8-19/h2-13,16H,14-15H2,1H3 |
| InChIKey | RUDLNSZKCLCPRE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|