C24H20N4O2S — CID 2426640
1-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2426640) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 2426640 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[2-(3-methylphenoxy)ethylsulfanyl]-4-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1cccc(OCCSc2nnc3n(-c4ccccc4)c(=O)c4ccccc4n23)c1 |
| InChI | InChI=1S/C24H20N4O2S/c1-17-8-7-11-19(16-17)30-14-15-31-24-26-25-23-27(18-9-3-2-4-10-18)22(29)20-12-5-6-13-21(20)28(23)24/h2-13,16H,14-15H2,1H3 |
| InChIKey | NNNIKUQFHKPAKJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|