C20H22N5O2S+ — CID 2101844
2-hydroxyethyl-[2-[[4-(3-methylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]ethyl]azanium (PubChem CID 2101844) has the molecular formula C20H22N5O2S+ and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-hydroxyethyl-[2-[[4-(3-methylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]ethyl]azanium.
| Compound Name | 2-hydroxyethyl-[2-[[4-(3-methylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]ethyl]azanium |
|---|---|
| PubChem CID | 2101844 |
| Molecular Formula | C20H22N5O2S+ |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-hydroxyethyl-[2-[[4-(3-methylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]ethyl]azanium |
| SMILES | Cc1cccc(-n2c(=O)c3ccccc3n3c(SCC[NH2+]CCO)nnc23)c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-14-5-4-6-15(13-14)24-18(27)16-7-2-3-8-17(16)25-19(24)22-23-20(25)28-12-10-21-9-11-26/h2-8,13,21,26H,9-12H2,1H3/p+1 |
| InChIKey | HDCMGLMZXKWPPK-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|