C21H19N5O2S — CID 60514327
3-[2-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]ethoxy]benzonitrile (PubChem CID 60514327) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-[2-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 60514327 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[2-[(5-oxo-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]ethoxy]benzonitrile |
| SMILES | CCCn1c(=O)c2ccccc2n2c(SCCOc3cccc(C#N)c3)nnc12 |
| InChI | InChI=1S/C21H19N5O2S/c1-2-10-25-19(27)17-8-3-4-9-18(17)26-20(25)23-24-21(26)29-12-11-28-16-7-5-6-15(13-16)14-22/h3-9,13H,2,10-12H2,1H3 |
| InChIKey | CFSQDKZYLUQMOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|