C21H17ClN4OS — CID 7855327
4-[4-(4-chlorophenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 7855327) has the molecular formula C21H17ClN4OS and a molecular weight of 408.91 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-chlorophenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 7855327 |
| Molecular Formula | C21H17ClN4OS |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | Clc1ccc(-n2c(SCCOc3ccccc3)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H17ClN4OS/c22-17-6-8-18(9-7-17)26-20(16-10-12-23-13-11-16)24-25-21(26)28-15-14-27-19-4-2-1-3-5-19/h1-13H,14-15H2 |
| InChIKey | QPZXGKJJDQDPTI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|