C17H17ClN4OS — CID 78761427
4-[4-(4-chlorophenyl)-5-(2-ethoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 78761427) has the molecular formula C17H17ClN4OS and a molecular weight of 360.87 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-5-(2-ethoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-chlorophenyl)-5-(2-ethoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 78761427 |
| Molecular Formula | C17H17ClN4OS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-5-(2-ethoxyethylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | CCOCCSc1nnc(-c2ccncc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4OS/c1-2-23-11-12-24-17-21-20-16(13-7-9-19-10-8-13)22(17)15-5-3-14(18)4-6-15/h3-10H,2,11-12H2,1H3 |
| InChIKey | JXSGXGMDGPDCJD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|