C22H16Cl3N3OS — CID 126105675
3-[2-(2-chlorophenoxy)ethylsulfanyl]-4,5-bis(4-chlorophenyl)-1,2,4-triazole (PubChem CID 126105675) has the molecular formula C22H16Cl3N3OS and a molecular weight of 476.82 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethylsulfanyl]-4,5-bis(4-chlorophenyl)-1,2,4-triazole.
| Compound Name | 3-[2-(2-chlorophenoxy)ethylsulfanyl]-4,5-bis(4-chlorophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 126105675 |
| Molecular Formula | C22H16Cl3N3OS |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethylsulfanyl]-4,5-bis(4-chlorophenyl)-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nnc(SCCOc3ccccc3Cl)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl3N3OS/c23-16-7-5-15(6-8-16)21-26-27-22(28(21)18-11-9-17(24)10-12-18)30-14-13-29-20-4-2-1-3-19(20)25/h1-12H,13-14H2 |
| InChIKey | LEAQCLOACQWLGX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|