C17H18N2O2S2 — CID 35200708
3-ethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 35200708) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 35200708 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-ethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(SCCOc2cccc(C)c2)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H18N2O2S2/c1-3-19-16(20)15-14(7-9-22-15)18-17(19)23-10-8-21-13-6-4-5-12(2)11-13/h4-7,9,11H,3,8,10H2,1-2H3 |
| InChIKey | DGJGXMSPNUSFFP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|