C11H14N2OS2 — CID 3484012
3-ethyl-2-propylsulfanylthieno[3,2-d]pyrimidin-4-one (PubChem CID 3484012) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-ethyl-2-propylsulfanylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-propylsulfanylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3484012 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-ethyl-2-propylsulfanylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCSc1nc2ccsc2c(=O)n1CC |
| InChI | InChI=1S/C11H14N2OS2/c1-3-6-16-11-12-8-5-7-15-9(8)10(14)13(11)4-2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | VOIXOROFDRQDIM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |