C14H15N3O3S2 — CID 38663357
1-[2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylethyl]pyrrolidine-2,5-dione (PubChem CID 38663357) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 38663357 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-[2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylethyl]pyrrolidine-2,5-dione |
| SMILES | CCn1c(SCCN2C(=O)CCC2=O)nc2ccsc2c1=O |
| InChI | InChI=1S/C14H15N3O3S2/c1-2-16-13(20)12-9(5-7-21-12)15-14(16)22-8-6-17-10(18)3-4-11(17)19/h5,7H,2-4,6,8H2,1H3 |
| InChIKey | ZTBQHWBERYBPTJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|