C15H16N4O3S3 — CID 17418415
4-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 17418415) has the molecular formula C15H16N4O3S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 17418415 |
| Molecular Formula | C15H16N4O3S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | Cn1c(SCCOc2ccc(S(N)(=O)=O)cc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C15H16N4O3S3/c1-19-14(13-3-2-9-23-13)17-18-15(19)24-10-8-22-11-4-6-12(7-5-11)25(16,20)21/h2-7,9H,8,10H2,1H3,(H2,16,20,21) |
| InChIKey | FSBLMUHXEPDDBK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|