C19H20N4O5S2 — CID 55399909
4-[2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 55399909) has the molecular formula C19H20N4O5S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 55399909 |
| Molecular Formula | C19H20N4O5S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-[2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | Cn1c(SCCOc2ccc(S(N)(=O)=O)cc2)nnc1C1COc2ccccc2O1 |
| InChI | InChI=1S/C19H20N4O5S2/c1-23-18(17-12-27-15-4-2-3-5-16(15)28-17)21-22-19(23)29-11-10-26-13-6-8-14(9-7-13)30(20,24)25/h2-9,17H,10-12H2,1H3,(H2,20,24,25) |
| InChIKey | RXTAKCUTPXXWQQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|