C19H21FN4O2S2 — CID 60517598
N-[3-(4-fluorophenoxy)propyl]-N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 60517598) has the molecular formula C19H21FN4O2S2 and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 60517598 |
| Molecular Formula | C19H21FN4O2S2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CN(CCCOc1ccc(F)cc1)C(=O)CSc1nnc(-c2cccs2)n1C |
| InChI | InChI=1S/C19H21FN4O2S2/c1-23(10-4-11-26-15-8-6-14(20)7-9-15)17(25)13-28-19-22-21-18(24(19)2)16-5-3-12-27-16/h3,5-9,12H,4,10-11,13H2,1-2H3 |
| InChIKey | DCKUAEHNFXZYPB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|