C15H15ClN4OS2 — CID 16592519
3-[3-(4-chlorophenoxy)propylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-amine (PubChem CID 16592519) has the molecular formula C15H15ClN4OS2 and a molecular weight of 366.90 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-amine.
| Compound Name | 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 16592519 |
| Molecular Formula | C15H15ClN4OS2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCCOc2ccc(Cl)cc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C15H15ClN4OS2/c16-11-4-6-12(7-5-11)21-8-2-10-23-15-19-18-14(20(15)17)13-3-1-9-22-13/h1,3-7,9H,2,8,10,17H2 |
| InChIKey | BYQZTPJEDRSCFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|