C10H11N5S2 — CID 47105944
4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanenitrile (PubChem CID 47105944) has the molecular formula C10H11N5S2 and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanenitrile.
| Compound Name | 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 47105944 |
| Molecular Formula | C10H11N5S2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanenitrile |
| SMILES | N#CCCCSc1nnc(-c2cccs2)n1N |
| InChI | InChI=1S/C10H11N5S2/c11-5-1-2-6-17-10-14-13-9(15(10)12)8-4-3-7-16-8/h3-4,7H,1-2,6,12H2 |
| InChIKey | HDGPVTVFFUWMSZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|