C12H12N6OS2 — CID 8000914
4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile (PubChem CID 8000914) has the molecular formula C12H12N6OS2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile.
| Compound Name | 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 8000914 |
| Molecular Formula | C12H12N6OS2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-[(4-amino-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1nnc(-c2cccs2)n1N |
| InChI | InChI=1S/C12H12N6OS2/c1-7(14)8(5-13)9(19)6-21-12-17-16-11(18(12)15)10-3-2-4-20-10/h2-4,8,14H,6,15H2,1H3/b14-7+ |
| InChIKey | QMSZMHLUWMBADO-VGOFMYFVSA-N |
| XLogP | 1.56 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|