C17H16FN5OS — CID 7826304
2-ethanimidoyl-4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile (PubChem CID 7826304) has the molecular formula C17H16FN5OS and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-ethanimidoyl-4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile.
| Compound Name | 2-ethanimidoyl-4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7826304 |
| Molecular Formula | C17H16FN5OS |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-ethanimidoyl-4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1nnc(-c2ccc(F)cc2)n1CC=C |
| InChI | InChI=1S/C17H16FN5OS/c1-3-8-23-16(12-4-6-13(18)7-5-12)21-22-17(23)25-10-15(24)14(9-19)11(2)20/h3-7,14,20H,1,8,10H2,2H3/b20-11+ |
| InChIKey | FUXJMWXHDBWZBI-RGVLZGJSSA-N |
| XLogP | 3.11 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|