C20H19FN4OS — CID 2575279
N-benzyl-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2575279) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is N-benzyl-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2575279 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-benzyl-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccccc2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN4OS/c1-2-12-25-19(16-8-10-17(21)11-9-16)23-24-20(25)27-14-18(26)22-13-15-6-4-3-5-7-15/h2-11H,1,12-14H2,(H,22,26) |
| InChIKey | HFVUMGCLTPEXPI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|