C18H23FN4OS — CID 2575092
2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylbutyl)acetamide (PubChem CID 2575092) has the molecular formula C18H23FN4OS and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 2575092 |
| Molecular Formula | C18H23FN4OS |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylbutyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCC(C)C)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4OS/c1-4-11-23-17(14-5-7-15(19)8-6-14)21-22-18(23)25-12-16(24)20-10-9-13(2)3/h4-8,13H,1,9-12H2,2-3H3,(H,20,24) |
| InChIKey | ZCZJVOJCGUQSTI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|