C20H18N6OS — CID 7839068
4-[(4-benzyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile (PubChem CID 7839068) has the molecular formula C20H18N6OS and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[(4-benzyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile.
| Compound Name | 4-[(4-benzyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7839068 |
| Molecular Formula | C20H18N6OS |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-[(4-benzyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1nnc(-c2cccnc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N6OS/c1-14(22)17(10-21)18(27)13-28-20-25-24-19(16-8-5-9-23-11-16)26(20)12-15-6-3-2-4-7-15/h2-9,11,17,22H,12-13H2,1H3/b22-14+ |
| InChIKey | NLZFVNHVPPQAAD-HYARGMPZSA-N |
| XLogP | 3.23 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|