C21H18FN5OS — CID 7147897
4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile (PubChem CID 7147897) has the molecular formula C21H18FN5OS and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile.
| Compound Name | 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7147897 |
| Molecular Formula | C21H18FN5OS |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1nnc(-c2ccccc2F)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H18FN5OS/c1-14(24)17(11-23)19(28)13-29-21-26-25-20(16-9-5-6-10-18(16)22)27(21)12-15-7-3-2-4-8-15/h2-10,17,24H,12-13H2,1H3/b24-14+ |
| InChIKey | HJAANULTUPCXLU-ZVHZXABRSA-N |
| XLogP | 3.97 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|