C27H27FN4OS — CID 4850739
4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dimethylphenyl)butanamide (PubChem CID 4850739) has the molecular formula C27H27FN4OS and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dimethylphenyl)butanamide.
| Compound Name | 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 4850739 |
| Molecular Formula | C27H27FN4OS |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 4-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dimethylphenyl)butanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSc1nnc(-c2ccccc2F)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H27FN4OS/c1-19-10-8-11-20(2)25(19)29-24(33)16-9-17-34-27-31-30-26(22-14-6-7-15-23(22)28)32(27)18-21-12-4-3-5-13-21/h3-8,10-15H,9,16-18H2,1-2H3,(H,29,33) |
| InChIKey | GAQGUTBKWFRSAD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|