C21H21FN4O2S — CID 47772477
3-[3-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,3-oxazolidin-2-one (PubChem CID 47772477) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[3-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 47772477 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-[3-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCCSc1nnc(-c2ccccc2F)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H21FN4O2S/c22-18-10-5-4-9-17(18)19-23-24-20(26(19)15-16-7-2-1-3-8-16)29-14-6-11-25-12-13-28-21(25)27/h1-5,7-10H,6,11-15H2 |
| InChIKey | HFNHMNDXNTWZMH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|