C16H17ClN4O2S — CID 24596592
3-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2-methylfuran-3-yl)-1,2,4-triazol-4-amine (PubChem CID 24596592) has the molecular formula C16H17ClN4O2S and a molecular weight of 364.86 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2-methylfuran-3-yl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2-methylfuran-3-yl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 24596592 |
| Molecular Formula | C16H17ClN4O2S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2-methylfuran-3-yl)-1,2,4-triazol-4-amine |
| SMILES | Cc1occc1-c1nnc(SCCCOc2ccc(Cl)cc2)n1N |
| InChI | InChI=1S/C16H17ClN4O2S/c1-11-14(7-9-22-11)15-19-20-16(21(15)18)24-10-2-8-23-13-5-3-12(17)4-6-13/h3-7,9H,2,8,10,18H2,1H3 |
| InChIKey | LMPWUYDSQAPKNC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|