C15H15N5O4S — CID 46484012
3-(2-methylfuran-3-yl)-5-[2-(3-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 46484012) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-(2-methylfuran-3-yl)-5-[2-(3-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-methylfuran-3-yl)-5-[2-(3-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 46484012 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 3-(2-methylfuran-3-yl)-5-[2-(3-nitrophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1occc1-c1nnc(SCCOc2cccc([N+](=O)[O-])c2)n1N |
| InChI | InChI=1S/C15H15N5O4S/c1-10-13(5-6-23-10)14-17-18-15(19(14)16)25-8-7-24-12-4-2-3-11(9-12)20(21)22/h2-6,9H,7-8,16H2,1H3 |
| InChIKey | RNYXAUHDPMTBHX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|