C17H14F3N5O3S — CID 60597214
4-[5-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 60597214) has the molecular formula C17H14F3N5O3S and a molecular weight of 425.39 g/mol. Its IUPAC name is 4-[5-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[5-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 60597214 |
| Molecular Formula | C17H14F3N5O3S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-[5-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | O=[N+]([O-])c1cccc(OCCSc2nnc(-c3ccncc3)n2CC(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3N5O3S/c18-17(19,20)11-24-15(12-4-6-21-7-5-12)22-23-16(24)29-9-8-28-14-3-1-2-13(10-14)25(26)27/h1-7,10H,8-9,11H2 |
| InChIKey | HUKOZFBZSJPPAI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|