C20H22N4O4S — CID 112796234
1-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 112796234) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 112796234 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | CCn1c(SCC(O)COc2cccc([N+](=O)[O-])c2)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-3-23-19(15-7-4-6-14(2)10-15)21-22-20(23)29-13-17(25)12-28-18-9-5-8-16(11-18)24(26)27/h4-11,17,25H,3,12-13H2,1-2H3 |
| InChIKey | UQIRBWZKYDNSLU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|