C17H14N4O4S2 — CID 55410196
1-(3-nitrophenoxy)-3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propan-2-ol (PubChem CID 55410196) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-(3-nitrophenoxy)-3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propan-2-ol.
| Compound Name | 1-(3-nitrophenoxy)-3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 55410196 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1-(3-nitrophenoxy)-3-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OCC(O)CSc2nnc3sc4ccccc4n23)c1 |
| InChI | InChI=1S/C17H14N4O4S2/c22-12(9-25-13-5-3-4-11(8-13)21(23)24)10-26-16-18-19-17-20(16)14-6-1-2-7-15(14)27-17/h1-8,12,22H,9-10H2 |
| InChIKey | SXZLOCPJKDJGMS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|