C22H31N5O5S — CID 42933886
1-[[5-(4-methylpiperidin-1-yl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 42933886) has the molecular formula C22H31N5O5S and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-[[5-(4-methylpiperidin-1-yl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[[5-(4-methylpiperidin-1-yl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 42933886 |
| Molecular Formula | C22H31N5O5S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[[5-(4-methylpiperidin-1-yl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | CC1CCN(c2nnc(SCC(O)COc3cccc([N+](=O)[O-])c3)n2CC2CCCO2)CC1 |
| InChI | InChI=1S/C22H31N5O5S/c1-16-7-9-25(10-8-16)21-23-24-22(26(21)13-20-6-3-11-31-20)33-15-18(28)14-32-19-5-2-4-17(12-19)27(29)30/h2,4-5,12,16,18,20,28H,3,6-11,13-15H2,1H3 |
| InChIKey | PBOMUAMRZHTUCH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|