C20H26N6O6S — CID 16961403
N-(2-methoxy-4-nitrophenyl)-2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16961403) has the molecular formula C20H26N6O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16961403 |
| Molecular Formula | C20H26N6O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(N2CCOCC2)n1CC1CCCO1 |
| InChI | InChI=1S/C20H26N6O6S/c1-30-17-11-14(26(28)29)4-5-16(17)21-18(27)13-33-20-23-22-19(24-6-9-31-10-7-24)25(20)12-15-3-2-8-32-15/h4-5,11,15H,2-3,6-10,12-13H2,1H3,(H,21,27) |
| InChIKey | LLMKEAQYIGBRRB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|