C22H26N6O5S — CID 42930932
2-[[4-(furan-2-ylmethyl)-5-(3-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 42930932) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-(3-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-(3-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42930932 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-(3-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(N2CCCC(C)C2)n1Cc1ccco1 |
| InChI | InChI=1S/C22H26N6O5S/c1-15-5-3-9-26(12-15)21-24-25-22(27(21)13-17-6-4-10-33-17)34-14-20(29)23-18-8-7-16(28(30)31)11-19(18)32-2/h4,6-8,10-11,15H,3,5,9,12-14H2,1-2H3,(H,23,29) |
| InChIKey | MCDKTPOTWMJYEE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|