C19H18Cl3N5O2S — CID 16586726
2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 16586726) has the molecular formula C19H18Cl3N5O2S and a molecular weight of 486.81 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 16586726 |
| Molecular Formula | C19H18Cl3N5O2S |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(N2CCCC2)n1Cc1ccco1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl3N5O2S/c20-13-8-15(22)16(9-14(13)21)23-17(28)11-30-19-25-24-18(26-5-1-2-6-26)27(19)10-12-4-3-7-29-12/h3-4,7-9H,1-2,5-6,10-11H2,(H,23,28) |
| InChIKey | YOHXERILSSDQKF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|