C20H22N6O4S — CID 16961469
2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 16961469) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16961469 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(N3CCCC3)n2Cc2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N6O4S/c1-14-6-7-15(11-17(14)26(28)29)21-18(27)13-31-20-23-22-19(24-8-2-3-9-24)25(20)12-16-5-4-10-30-16/h4-7,10-11H,2-3,8-9,12-13H2,1H3,(H,21,27) |
| InChIKey | DTVJYQJLWUHNKA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|