C24H34N6O3S — CID 16585592
2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 16585592) has the molecular formula C24H34N6O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 16585592 |
| Molecular Formula | C24H34N6O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[[5-morpholin-4-yl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(N2CCOCC2)n1CC1CCCO1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N6O3S/c31-22(25-19-6-8-20(9-7-19)28-10-2-1-3-11-28)18-34-24-27-26-23(29-12-15-32-16-13-29)30(24)17-21-5-4-14-33-21/h6-9,21H,1-5,10-18H2,(H,25,31) |
| InChIKey | RGXSSOCJEWUXLB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|