C21H22ClN3O2S — CID 78661775
1-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylphenoxy)propan-2-ol (PubChem CID 78661775) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylphenoxy)propan-2-ol.
| Compound Name | 1-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 78661775 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylphenoxy)propan-2-ol |
| SMILES | C=CCn1c(SCC(O)COc2cccc(C)c2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-3-11-25-20(16-7-9-17(22)10-8-16)23-24-21(25)28-14-18(26)13-27-19-6-4-5-15(2)12-19/h3-10,12,18,26H,1,11,13-14H2,2H3 |
| InChIKey | QBYTVBBFIAYJJK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|